C30H31N3O11 — CID 54386661
2-oxo-7-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-N-[4-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)butyl]chromene-3-carboxamide (PubChem CID 54386661) has the molecular formula C30H31N3O11 and a molecular weight of 609.59 g/mol. Its IUPAC name is 2-oxo-7-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-N-[4-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)butyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-7-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-N-[4-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)butyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 54386661 |
| Molecular Formula | C30H31N3O11 |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | 2-oxo-7-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-N-[4-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)butyl]chromene-3-carboxamide |
| SMILES | O=C1NC(=O)C(CCCCNC(=O)c2cc3ccc([C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)cc3oc2=O)(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C30H31N3O11/c34-14-20-21(35)22(36)23(37)24(43-20)16-9-8-15-12-18(26(39)44-19(15)13-16)25(38)31-11-5-4-10-30(17-6-2-1-3-7-17)27(40)32-29(42)33-28(30)41/h1-3,6-9,12-13,20-24,34-37H,4-5,10-11,14H2,(H,31,38)(H2,32,33,40,41,42)/t20-,21+,22+,23-,24+/m1/s1 |
| InChIKey | VDSAGZOIUBABKH-BAHGYDIPSA-N |
| XLogP | -0.49 |
| TPSA | 224.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|