C30H34N2O10 — CID 118343786
[(4R,5S)-5-hydroxy-6-[3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate (PubChem CID 118343786) has the molecular formula C30H34N2O10 and a molecular weight of 582.61 g/mol. Its IUPAC name is [(4R,5S)-5-hydroxy-6-[3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate.
| Compound Name | [(4R,5S)-5-hydroxy-6-[3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
|---|---|
| PubChem CID | 118343786 |
| Molecular Formula | C30H34N2O10 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | [(4R,5S)-5-hydroxy-6-[3-[[4-hydroxy-3-(3-methylbut-2-enyl)benzoyl]amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] carbamate |
| SMILES | COC1[C@H](OC(N)=O)[C@H](O)C(Oc2ccc3cc(NC(=O)c4ccc(O)c(CC=C(C)C)c4)c(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C30H34N2O10/c1-15(2)6-7-16-12-18(9-11-21(16)33)26(35)32-20-13-17-8-10-19(14-22(17)40-27(20)36)39-28-23(34)24(41-29(31)37)25(38-5)30(3,4)42-28/h6,8-14,23-25,28,33-34H,7H2,1-5H3,(H2,31,37)(H,32,35)/t23-,24+,25?,28?/m0/s1 |
| InChIKey | HOWKSUTVRAYNGQ-WTGMYAAYSA-N |
| XLogP | 3.61 |
| TPSA | 179.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|