C24H26O7 — CID 89138143
7-[(2R,4R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-methyl-3-phenylchromen-2-one (PubChem CID 89138143) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is 7-[(2R,4R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-methyl-3-phenylchromen-2-one.
| Compound Name | 7-[(2R,4R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-methyl-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 89138143 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 7-[(2R,4R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-methyl-3-phenylchromen-2-one |
| SMILES | CO[C@@H]1[C@H](O)C(O)[C@H](Oc2ccc3c(C)c(-c4ccccc4)c(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C24H26O7/c1-13-16-11-10-15(29-23-20(26)19(25)21(28-4)24(2,3)31-23)12-17(16)30-22(27)18(13)14-8-6-5-7-9-14/h5-12,19-21,23,25-26H,1-4H3/t19-,20?,21-,23-/m1/s1 |
| InChIKey | HSPVSCUTVGQRGO-OHARJQELSA-N |
| XLogP | 3.02 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|