C35H37NO6 — CID 16664652
5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(2-phenylethyl)-2-(4-phenylphenyl)benzamide (PubChem CID 16664652) has the molecular formula C35H37NO6 and a molecular weight of 567.68 g/mol. Its IUPAC name is 5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(2-phenylethyl)-2-(4-phenylphenyl)benzamide.
| Compound Name | 5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(2-phenylethyl)-2-(4-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 16664652 |
| Molecular Formula | C35H37NO6 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | 5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(2-phenylethyl)-2-(4-phenylphenyl)benzamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc(-c3ccc(-c4ccccc4)cc3)c(C(=O)NCCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C35H37NO6/c1-35(2)32(40-3)30(37)31(38)34(42-35)41-27-18-19-28(26-16-14-25(15-17-26)24-12-8-5-9-13-24)29(22-27)33(39)36-21-20-23-10-6-4-7-11-23/h4-19,22,30-32,34,37-38H,20-21H2,1-3H3,(H,36,39)/t30-,31+,32+,34+/m0/s1 |
| InChIKey | MVVUCVQHDSONTE-ILVDDAPESA-N |
| XLogP | 5.24 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |