C28H31NO6 — CID 16664408
N-benzyl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-phenylbenzamide (PubChem CID 16664408) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-benzyl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-phenylbenzamide.
| Compound Name | N-benzyl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-phenylbenzamide |
|---|---|
| PubChem CID | 16664408 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-benzyl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-phenylbenzamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@@H](Oc2ccc(-c3ccccc3)c(C(=O)NCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C28H31NO6/c1-28(2)25(33-3)23(30)24(31)27(35-28)34-20-14-15-21(19-12-8-5-9-13-19)22(16-20)26(32)29-17-18-10-6-4-7-11-18/h4-16,23-25,27,30-31H,17H2,1-3H3,(H,29,32)/t23-,24+,25+,27-/m0/s1 |
| InChIKey | LHAMLHSJSZJTLB-FCRYVSRXSA-N |
| XLogP | 3.53 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |