C29H33NO7 — CID 102086891
N-benzyl-5-[(2R,3R,4S,5S)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-(4-methoxyphenyl)benzamide (PubChem CID 102086891) has the molecular formula C29H33NO7 and a molecular weight of 507.58 g/mol. Its IUPAC name is N-benzyl-5-[(2R,3R,4S,5S)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-(4-methoxyphenyl)benzamide.
| Compound Name | N-benzyl-5-[(2R,3R,4S,5S)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 102086891 |
| Molecular Formula | C29H33NO7 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-benzyl-5-[(2R,3R,4S,5S)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(-c2ccc(O[C@@H]3OC(C)(C)[C@@H](OC)[C@@H](O)[C@H]3O)cc2C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H33NO7/c1-29(2)26(35-4)24(31)25(32)28(37-29)36-21-14-15-22(19-10-12-20(34-3)13-11-19)23(16-21)27(33)30-17-18-8-6-5-7-9-18/h5-16,24-26,28,31-32H,17H2,1-4H3,(H,30,33)/t24-,25+,26-,28+/m0/s1 |
| InChIKey | MHNIVZGWSZKEQG-WLBXEJSFSA-N |
| XLogP | 3.54 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |