C36H37NO7 — CID 16665001
2-dibenzofuran-4-yl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(3-phenylpropyl)benzamide (PubChem CID 16665001) has the molecular formula C36H37NO7 and a molecular weight of 595.69 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(3-phenylpropyl)benzamide.
| Compound Name | 2-dibenzofuran-4-yl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 16665001 |
| Molecular Formula | C36H37NO7 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 2-dibenzofuran-4-yl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(3-phenylpropyl)benzamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@@H](Oc2ccc(-c3cccc4c3oc3ccccc34)c(C(=O)NCCCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C36H37NO7/c1-36(2)33(41-3)30(38)31(39)35(44-36)42-23-18-19-24(26-15-9-16-27-25-14-7-8-17-29(25)43-32(26)27)28(21-23)34(40)37-20-10-13-22-11-5-4-6-12-22/h4-9,11-12,14-19,21,30-31,33,35,38-39H,10,13,20H2,1-3H3,(H,37,40)/t30-,31+,33+,35-/m0/s1 |
| InChIKey | LMEWXLUQVSJBBT-GASCRMCBSA-N |
| XLogP | 5.87 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|