C34H35NO7 — CID 16664653
N-benzyl-5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-(4-phenoxyphenyl)benzamide (PubChem CID 16664653) has the molecular formula C34H35NO7 and a molecular weight of 569.65 g/mol. Its IUPAC name is N-benzyl-5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-(4-phenoxyphenyl)benzamide.
| Compound Name | N-benzyl-5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 16664653 |
| Molecular Formula | C34H35NO7 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | N-benzyl-5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-(4-phenoxyphenyl)benzamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc(-c3ccc(Oc4ccccc4)cc3)c(C(=O)NCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C34H35NO7/c1-34(2)31(39-3)29(36)30(37)33(42-34)41-26-18-19-27(28(20-26)32(38)35-21-22-10-6-4-7-11-22)23-14-16-25(17-15-23)40-24-12-8-5-9-13-24/h4-20,29-31,33,36-37H,21H2,1-3H3,(H,35,38)/t29-,30+,31+,33+/m0/s1 |
| InChIKey | ORJVIAIBWQQPAU-AMTAJSKDSA-N |
| XLogP | 5.33 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |