C35H35NO7 — CID 16665005
2-dibenzofuran-4-yl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(2-phenylethyl)benzamide (PubChem CID 16665005) has the molecular formula C35H35NO7 and a molecular weight of 581.67 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(2-phenylethyl)benzamide.
| Compound Name | 2-dibenzofuran-4-yl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 16665005 |
| Molecular Formula | C35H35NO7 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 2-dibenzofuran-4-yl-5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-N-(2-phenylethyl)benzamide |
| SMILES | COC1[C@@H](O)[C@@H](O)[C@@H](Oc2ccc(-c3cccc4c3oc3ccccc34)c(C(=O)NCCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C35H35NO7/c1-35(2)32(40-3)29(37)30(38)34(43-35)41-22-16-17-23(27(20-22)33(39)36-19-18-21-10-5-4-6-11-21)25-13-9-14-26-24-12-7-8-15-28(24)42-31(25)26/h4-17,20,29-30,32,34,37-38H,18-19H2,1-3H3,(H,36,39)/t29-,30+,32?,34-/m0/s1 |
| InChIKey | VFXIDMOVUCVCBJ-CTXSZVAISA-N |
| XLogP | 5.48 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |