C27H24N2O — CID 91363537
N-benzyl-5-(3,5-dimethylphenyl)-2-pyridin-3-ylbenzamide (PubChem CID 91363537) has the molecular formula C27H24N2O and a molecular weight of 392.50 g/mol. Its IUPAC name is N-benzyl-5-(3,5-dimethylphenyl)-2-pyridin-3-ylbenzamide.
| Compound Name | N-benzyl-5-(3,5-dimethylphenyl)-2-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 91363537 |
| Molecular Formula | C27H24N2O |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-benzyl-5-(3,5-dimethylphenyl)-2-pyridin-3-ylbenzamide |
| SMILES | Cc1cc(C)cc(-c2ccc(-c3cccnc3)c(C(=O)NCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H24N2O/c1-19-13-20(2)15-24(14-19)22-10-11-25(23-9-6-12-28-18-23)26(16-22)27(30)29-17-21-7-4-3-5-8-21/h3-16,18H,17H2,1-2H3,(H,29,30) |
| InChIKey | DBEHTDPKKCAJCP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |