C33H37BrO9Si — CID 10842313
[(2S,3R,4S,5R,6R)-4,5-dibenzoyloxy-2-(bromomethyl)-6-(2-trimethylsilylethoxy)oxan-3-yl] 4-methoxybenzoate (PubChem CID 10842313) has the molecular formula C33H37BrO9Si and a molecular weight of 685.64 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4,5-dibenzoyloxy-2-(bromomethyl)-6-(2-trimethylsilylethoxy)oxan-3-yl] 4-methoxybenzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-4,5-dibenzoyloxy-2-(bromomethyl)-6-(2-trimethylsilylethoxy)oxan-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 10842313 |
| Molecular Formula | C33H37BrO9Si |
| Molecular Weight | 685.64 g/mol |
| Exact Mass | 684.14 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4,5-dibenzoyloxy-2-(bromomethyl)-6-(2-trimethylsilylethoxy)oxan-3-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H]2[C@H](OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OCC[Si](C)(C)C)O[C@@H]2CBr)cc1 |
| InChI | InChI=1S/C33H37BrO9Si/c1-38-25-17-15-24(16-18-25)32(37)41-27-26(21-34)40-33(39-19-20-44(2,3)4)29(43-31(36)23-13-9-6-10-14-23)28(27)42-30(35)22-11-7-5-8-12-22/h5-18,26-29,33H,19-21H2,1-4H3/t26-,27+,28+,29-,33-/m1/s1 |
| InChIKey | XRBJKHILZRSQKY-SMWBDTCFSA-N |
| XLogP | 6.15 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|