C23H24O5 — CID 58341408
[(3R,4R,5R)-3-benzoyloxy-3-ethenyl-5-ethyl-4-methyloxolan-2-yl] benzoate (PubChem CID 58341408) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(3R,4R,5R)-3-benzoyloxy-3-ethenyl-5-ethyl-4-methyloxolan-2-yl] benzoate.
| Compound Name | [(3R,4R,5R)-3-benzoyloxy-3-ethenyl-5-ethyl-4-methyloxolan-2-yl] benzoate |
|---|---|
| PubChem CID | 58341408 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [(3R,4R,5R)-3-benzoyloxy-3-ethenyl-5-ethyl-4-methyloxolan-2-yl] benzoate |
| SMILES | C=C[C@]1(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)O[C@H](CC)[C@H]1C |
| InChI | InChI=1S/C23H24O5/c1-4-19-16(3)23(5-2,28-21(25)18-14-10-7-11-15-18)22(26-19)27-20(24)17-12-8-6-9-13-17/h5-16,19,22H,2,4H2,1,3H3/t16-,19-,22?,23-/m1/s1 |
| InChIKey | QDVCCEZBYVFXJU-YFBBYZQQSA-N |
| XLogP | 4.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|