C24H22F2O8S — CID 178184535
[(2R,3R,5R)-4,4-difluoro-5-methylsulfonyloxy-3-(3-phenylprop-2-enoyloxy)oxolan-2-yl]methyl 3-phenylprop-2-enoate (PubChem CID 178184535) has the molecular formula C24H22F2O8S and a molecular weight of 508.50 g/mol. Its IUPAC name is [(2R,3R,5R)-4,4-difluoro-5-methylsulfonyloxy-3-(3-phenylprop-2-enoyloxy)oxolan-2-yl]methyl 3-phenylprop-2-enoate.
| Compound Name | [(2R,3R,5R)-4,4-difluoro-5-methylsulfonyloxy-3-(3-phenylprop-2-enoyloxy)oxolan-2-yl]methyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 178184535 |
| Molecular Formula | C24H22F2O8S |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | [(2R,3R,5R)-4,4-difluoro-5-methylsulfonyloxy-3-(3-phenylprop-2-enoyloxy)oxolan-2-yl]methyl 3-phenylprop-2-enoate |
| SMILES | CS(=O)(=O)O[C@H]1O[C@H](COC(=O)C=Cc2ccccc2)[C@@H](OC(=O)C=Cc2ccccc2)C1(F)F |
| InChI | InChI=1S/C24H22F2O8S/c1-35(29,30)34-23-24(25,26)22(33-21(28)15-13-18-10-6-3-7-11-18)19(32-23)16-31-20(27)14-12-17-8-4-2-5-9-17/h2-15,19,22-23H,16H2,1H3/t19-,22-,23-/m1/s1 |
| InChIKey | NSHDCILJZDEEAO-UEVCKROQSA-N |
| XLogP | 3.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|