C32H33F2N3O7Si — CID 23635355
[(2R,3R,5R)-4,4-difluoro-5-[2-oxo-4-(1-trimethylsilyloxyethylideneamino)pyrimidin-1-yl]-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate (PubChem CID 23635355) has the molecular formula C32H33F2N3O7Si and a molecular weight of 637.71 g/mol. Its IUPAC name is [(2R,3R,5R)-4,4-difluoro-5-[2-oxo-4-(1-trimethylsilyloxyethylideneamino)pyrimidin-1-yl]-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3R,5R)-4,4-difluoro-5-[2-oxo-4-(1-trimethylsilyloxyethylideneamino)pyrimidin-1-yl]-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 23635355 |
| Molecular Formula | C32H33F2N3O7Si |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 637.21 |
| IUPAC Name | [(2R,3R,5R)-4,4-difluoro-5-[2-oxo-4-(1-trimethylsilyloxyethylideneamino)pyrimidin-1-yl]-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate |
| SMILES | C/C(=N\c1ccn([C@@H]2O[C@H](COC(=O)/C=C/c3ccccc3)[C@@H](OC(=O)/C=C/c3ccccc3)C2(F)F)c(=O)n1)O[Si](C)(C)C |
| InChI | InChI=1S/C32H33F2N3O7Si/c1-22(44-45(2,3)4)35-26-19-20-37(31(40)36-26)30-32(33,34)29(43-28(39)18-16-24-13-9-6-10-14-24)25(42-30)21-41-27(38)17-15-23-11-7-5-8-12-23/h5-20,25,29-30H,21H2,1-4H3/b17-15+,18-16+,35-22+/t25-,29-,30-/m1/s1 |
| InChIKey | CEGGZFQGSRLOCL-YEEKONESSA-N |
| XLogP | 5.56 |
| TPSA | 118.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|