C32H33F2N3O7Si — CID 69121741
[(2R,5R)-4,4-difluoro-5-[2-oxo-4-[(2-trimethylsilylacetyl)amino]pyrimidin-1-yl]-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate (PubChem CID 69121741) has the molecular formula C32H33F2N3O7Si and a molecular weight of 637.71 g/mol. Its IUPAC name is [(2R,5R)-4,4-difluoro-5-[2-oxo-4-[(2-trimethylsilylacetyl)amino]pyrimidin-1-yl]-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,5R)-4,4-difluoro-5-[2-oxo-4-[(2-trimethylsilylacetyl)amino]pyrimidin-1-yl]-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 69121741 |
| Molecular Formula | C32H33F2N3O7Si |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 637.21 |
| IUPAC Name | [(2R,5R)-4,4-difluoro-5-[2-oxo-4-[(2-trimethylsilylacetyl)amino]pyrimidin-1-yl]-3-[(E)-3-phenylprop-2-enoyl]oxyoxolan-2-yl]methyl (E)-3-phenylprop-2-enoate |
| SMILES | C[Si](C)(C)CC(=O)Nc1ccn([C@@H]2O[C@H](COC(=O)/C=C/c3ccccc3)C(OC(=O)/C=C/c3ccccc3)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C32H33F2N3O7Si/c1-45(2,3)21-26(38)35-25-18-19-37(31(41)36-25)30-32(33,34)29(44-28(40)17-15-23-12-8-5-9-13-23)24(43-30)20-42-27(39)16-14-22-10-6-4-7-11-22/h4-19,24,29-30H,20-21H2,1-3H3,(H,35,36,38,41)/b16-14+,17-15+/t24-,29?,30-/m1/s1 |
| InChIKey | SMMVMAQCGMRZMA-NMKAJEHFSA-N |
| XLogP | 4.93 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|