C14H18F2N6O5 — CID 142710995
[(2R,3R,5R)-5-(4-azido-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 142710995) has the molecular formula C14H18F2N6O5 and a molecular weight of 388.33 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(4-azido-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3R,5R)-5-(4-azido-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 142710995 |
| Molecular Formula | C14H18F2N6O5 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [(2R,3R,5R)-5-(4-azido-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC[C@H]1O[C@@H](n2ccc(N=[N+]=[N-])nc2=O)C(F)(F)[C@@H]1O |
| InChI | InChI=1S/C14H18F2N6O5/c1-6(2)9(17)11(24)26-5-7-10(23)14(15,16)12(27-7)22-4-3-8(20-21-18)19-13(22)25/h3-4,6-7,9-10,12,23H,5,17H2,1-2H3/t7-,9+,10-,12-/m1/s1 |
| InChIKey | BJVUVEMCSZNRNE-DLYFRVTGSA-N |
| XLogP | 0.61 |
| TPSA | 165.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|