C17H17F2N3O8 — CID 165157902
[3-acetyloxy-4,4-difluoro-5-[2-oxo-4-(prop-2-ynoxycarbonylamino)pyrimidin-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 165157902) has the molecular formula C17H17F2N3O8 and a molecular weight of 429.33 g/mol. Its IUPAC name is [3-acetyloxy-4,4-difluoro-5-[2-oxo-4-(prop-2-ynoxycarbonylamino)pyrimidin-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-4,4-difluoro-5-[2-oxo-4-(prop-2-ynoxycarbonylamino)pyrimidin-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 165157902 |
| Molecular Formula | C17H17F2N3O8 |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | [3-acetyloxy-4,4-difluoro-5-[2-oxo-4-(prop-2-ynoxycarbonylamino)pyrimidin-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | C#CCOC(=O)Nc1ccn(C2OC(COC(C)=O)C(OC(C)=O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C17H17F2N3O8/c1-4-7-27-16(26)21-12-5-6-22(15(25)20-12)14-17(18,19)13(29-10(3)24)11(30-14)8-28-9(2)23/h1,5-6,11,13-14H,7-8H2,2-3H3,(H,20,21,25,26) |
| InChIKey | STCLXBYOEXAKEM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|