C26H27F2N3O9 — CID 86718324
[(2R,3R,5R)-4,4-difluoro-5-[2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]-3-prop-2-enoxycarbonyloxyoxolan-2-yl]methyl 3-phenylpropanoate (PubChem CID 86718324) has the molecular formula C26H27F2N3O9 and a molecular weight of 563.51 g/mol. Its IUPAC name is [(2R,3R,5R)-4,4-difluoro-5-[2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]-3-prop-2-enoxycarbonyloxyoxolan-2-yl]methyl 3-phenylpropanoate.
| Compound Name | [(2R,3R,5R)-4,4-difluoro-5-[2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]-3-prop-2-enoxycarbonyloxyoxolan-2-yl]methyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 86718324 |
| Molecular Formula | C26H27F2N3O9 |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | [(2R,3R,5R)-4,4-difluoro-5-[2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]-3-prop-2-enoxycarbonyloxyoxolan-2-yl]methyl 3-phenylpropanoate |
| SMILES | C=CCOC(=O)Nc1ccn([C@@H]2O[C@H](COC(=O)CCc3ccccc3)[C@@H](OC(=O)OCC=C)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C26H27F2N3O9/c1-3-14-36-24(34)30-19-12-13-31(23(33)29-19)22-26(27,28)21(40-25(35)37-15-4-2)18(39-22)16-38-20(32)11-10-17-8-6-5-7-9-17/h3-9,12-13,18,21-22H,1-2,10-11,14-16H2,(H,29,30,33,34)/t18-,21-,22-/m1/s1 |
| InChIKey | LEDMBOCZAJXMCP-STZQEDGTSA-N |
| XLogP | 3.39 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|