C30H39F2N3O8 — CID 149335463
[(2R,3R,5R)-4,4-difluoro-5-[4-(heptoxycarbonylamino)-2-oxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] 6-oxo-7-phenylheptanoate (PubChem CID 149335463) has the molecular formula C30H39F2N3O8 and a molecular weight of 607.65 g/mol. Its IUPAC name is [(2R,3R,5R)-4,4-difluoro-5-[4-(heptoxycarbonylamino)-2-oxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] 6-oxo-7-phenylheptanoate.
| Compound Name | [(2R,3R,5R)-4,4-difluoro-5-[4-(heptoxycarbonylamino)-2-oxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] 6-oxo-7-phenylheptanoate |
|---|---|
| PubChem CID | 149335463 |
| Molecular Formula | C30H39F2N3O8 |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | [(2R,3R,5R)-4,4-difluoro-5-[4-(heptoxycarbonylamino)-2-oxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] 6-oxo-7-phenylheptanoate |
| SMILES | CCCCCCCOC(=O)Nc1ccn([C@@H]2O[C@H](CO)[C@@H](OC(=O)CCCCC(=O)Cc3ccccc3)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C30H39F2N3O8/c1-2-3-4-5-11-18-41-29(40)34-24-16-17-35(28(39)33-24)27-30(31,32)26(23(20-36)42-27)43-25(38)15-10-9-14-22(37)19-21-12-7-6-8-13-21/h6-8,12-13,16-17,23,26-27,36H,2-5,9-11,14-15,18-20H2,1H3,(H,33,34,39,40)/t23-,26-,27-/m1/s1 |
| InChIKey | YDDLWWSWJJRUKG-XSBVVTFOSA-N |
| XLogP | 4.57 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|