C22H19F2NO8S — CID 25179246
[(2R,3R)-4,4-difluoro-2-[(4-methylphenyl)sulfonylcarbamoyloxymethyl]-5-oxooxolan-3-yl] (E)-3-phenylprop-2-enoate (PubChem CID 25179246) has the molecular formula C22H19F2NO8S and a molecular weight of 495.46 g/mol. Its IUPAC name is [(2R,3R)-4,4-difluoro-2-[(4-methylphenyl)sulfonylcarbamoyloxymethyl]-5-oxooxolan-3-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3R)-4,4-difluoro-2-[(4-methylphenyl)sulfonylcarbamoyloxymethyl]-5-oxooxolan-3-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 25179246 |
| Molecular Formula | C22H19F2NO8S |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | [(2R,3R)-4,4-difluoro-2-[(4-methylphenyl)sulfonylcarbamoyloxymethyl]-5-oxooxolan-3-yl] (E)-3-phenylprop-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)OC[C@H]2OC(=O)C(F)(F)[C@@H]2OC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19F2NO8S/c1-14-7-10-16(11-8-14)34(29,30)25-21(28)31-13-17-19(22(23,24)20(27)32-17)33-18(26)12-9-15-5-3-2-4-6-15/h2-12,17,19H,13H2,1H3,(H,25,28)/b12-9+/t17-,19-/m1/s1 |
| InChIKey | VBYYQEWTUGOJKF-FDRWKTFPSA-N |
| XLogP | 2.60 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|