C20H25N2O5S+ — CID 7195255
[(2R)-4-benzylmorpholin-4-ium-2-yl]methyl N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 7195255) has the molecular formula C20H25N2O5S+ and a molecular weight of 405.50 g/mol. Its IUPAC name is [(2R)-4-benzylmorpholin-4-ium-2-yl]methyl N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [(2R)-4-benzylmorpholin-4-ium-2-yl]methyl N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 7195255 |
| Molecular Formula | C20H25N2O5S+ |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [(2R)-4-benzylmorpholin-4-ium-2-yl]methyl N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)OC[C@H]2C[NH+](Cc3ccccc3)CCO2)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-16-7-9-19(10-8-16)28(24,25)21-20(23)27-15-18-14-22(11-12-26-18)13-17-5-3-2-4-6-17/h2-10,18H,11-15H2,1H3,(H,21,23)/p+1/t18-/m1/s1 |
| InChIKey | OWIADZOKVAYOGG-GOSISDBHSA-O |
| XLogP | 0.89 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |