C24H23FN2O7 — CID 138059397
[(2S,3S,4S,5S)-3-benzoyloxy-5-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluoro-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 138059397) has the molecular formula C24H23FN2O7 and a molecular weight of 470.45 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-3-benzoyloxy-5-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluoro-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3S,4S,5S)-3-benzoyloxy-5-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluoro-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 138059397 |
| Molecular Formula | C24H23FN2O7 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [(2S,3S,4S,5S)-3-benzoyloxy-5-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluoro-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(F)[C@@H](N2CCC(=O)NC2=O)O[C@@H](COC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23FN2O7/c1-24(25)19(34-21(30)16-10-6-3-7-11-16)17(14-32-20(29)15-8-4-2-5-9-15)33-22(24)27-13-12-18(28)26-23(27)31/h2-11,17,19,22H,12-14H2,1H3,(H,26,28,31)/t17-,19-,22-,24-/m0/s1 |
| InChIKey | XFIAZPCJOCWSGF-JYFRSGACSA-N |
| XLogP | 2.46 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |