C30H31Cl3O8 — CID 15038232
[(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2,2,2-trichloroethyl carbonate (PubChem CID 15038232) has the molecular formula C30H31Cl3O8 and a molecular weight of 625.93 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2,2,2-trichloroethyl carbonate.
| Compound Name | [(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 15038232 |
| Molecular Formula | C30H31Cl3O8 |
| Molecular Weight | 625.93 g/mol |
| Exact Mass | 624.11 |
| IUPAC Name | [(2R,3R,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2,2,2-trichloroethyl carbonate |
| SMILES | O=C(OC[C@H]1OC(O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H31Cl3O8/c31-30(32,33)20-40-29(35)39-19-24-25(36-16-21-10-4-1-5-11-21)26(37-17-22-12-6-2-7-13-22)27(28(34)41-24)38-18-23-14-8-3-9-15-23/h1-15,24-28,34H,16-20H2/t24-,25-,26+,27-,28?/m1/s1 |
| InChIKey | FFXHIPPKWJHSBJ-GJMNKMQNSA-N |
| XLogP | 5.98 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.93 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|