C38H39Cl3NO12P — CID 163300004
benzyl [(2R,3S,4R,5R)-3-bis(phenylmethoxy)phosphoryloxy-6-hydroxy-4-phenylmethoxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl carbonate (PubChem CID 163300004) has the molecular formula C38H39Cl3NO12P and a molecular weight of 839.06 g/mol. Its IUPAC name is benzyl [(2R,3S,4R,5R)-3-bis(phenylmethoxy)phosphoryloxy-6-hydroxy-4-phenylmethoxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl carbonate.
| Compound Name | benzyl [(2R,3S,4R,5R)-3-bis(phenylmethoxy)phosphoryloxy-6-hydroxy-4-phenylmethoxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 163300004 |
| Molecular Formula | C38H39Cl3NO12P |
| Molecular Weight | 839.06 g/mol |
| Exact Mass | 837.13 |
| IUPAC Name | benzyl [(2R,3S,4R,5R)-3-bis(phenylmethoxy)phosphoryloxy-6-hydroxy-4-phenylmethoxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl carbonate |
| SMILES | O=C(N[C@H]1C(O)O[C@H](COC(=O)OCc2ccccc2)[C@@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)[C@@H]1OCc1ccccc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C38H39Cl3NO12P/c39-38(40,41)26-50-36(44)42-32-34(47-21-27-13-5-1-6-14-27)33(31(53-35(32)43)25-49-37(45)48-22-28-15-7-2-8-16-28)54-55(46,51-23-29-17-9-3-10-18-29)52-24-30-19-11-4-12-20-30/h1-20,31-35,43H,21-26H2,(H,42,44)/t31-,32-,33-,34-,35?/m1/s1 |
| InChIKey | KSTJDBUZRNOTOS-GMFYOBPESA-N |
| XLogP | 8.03 |
| TPSA | 157.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.06 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|