C13H17NO4 — CID 175511207
benzyl [3-(ethylamino)oxiran-2-yl]methyl carbonate (PubChem CID 175511207) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is benzyl [3-(ethylamino)oxiran-2-yl]methyl carbonate.
| Compound Name | benzyl [3-(ethylamino)oxiran-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 175511207 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | benzyl [3-(ethylamino)oxiran-2-yl]methyl carbonate |
| SMILES | CCNC1OC1COC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO4/c1-2-14-12-11(18-12)9-17-13(15)16-8-10-6-4-3-5-7-10/h3-7,11-12,14H,2,8-9H2,1H3 |
| InChIKey | GJWZHTBTZADMAZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|