C11H12O6 — CID 174610061
3-(oxiran-2-ylmethoxycarbonyl)-7-oxabicyclo[4.1.0]hept-1(6)-ene-2-carboxylic acid (PubChem CID 174610061) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is 3-(oxiran-2-ylmethoxycarbonyl)-7-oxabicyclo[4.1.0]hept-1(6)-ene-2-carboxylic acid.
| Compound Name | 3-(oxiran-2-ylmethoxycarbonyl)-7-oxabicyclo[4.1.0]hept-1(6)-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 174610061 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-(oxiran-2-ylmethoxycarbonyl)-7-oxabicyclo[4.1.0]hept-1(6)-ene-2-carboxylic acid |
| SMILES | O=C(OCC1CO1)C1CCC2=C(O2)C1C(=O)O |
| InChI | InChI=1S/C11H12O6/c12-10(13)8-6(1-2-7-9(8)17-7)11(14)16-4-5-3-15-5/h5-6,8H,1-4H2,(H,12,13) |
| InChIKey | FXPZLNSACPAVLQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|