C14H16O7 — CID 94864447
bis[[(2S)-oxiran-2-yl]methyl] (3S,4R,6R)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylate (PubChem CID 94864447) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is bis[[(2S)-oxiran-2-yl]methyl] (3S,4R,6R)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylate.
| Compound Name | bis[[(2S)-oxiran-2-yl]methyl] (3S,4R,6R)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 94864447 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | bis[[(2S)-oxiran-2-yl]methyl] (3S,4R,6R)-7-oxabicyclo[4.1.0]hept-1-ene-3,4-dicarboxylate |
| SMILES | O=C(OC[C@@H]1CO1)[C@H]1C=C2O[C@@H]2C[C@H]1C(=O)OC[C@@H]1CO1 |
| InChI | InChI=1S/C14H16O7/c15-13(19-5-7-3-17-7)9-1-11-12(21-11)2-10(9)14(16)20-6-8-4-18-8/h1,7-10,12H,2-6H2/t7-,8-,9-,10+,12+/m0/s1 |
| InChIKey | RUNBDQGENXJZOO-OFKSJOQMSA-N |
| XLogP | -0.21 |
| TPSA | 90.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|