C31H36N2O6 — CID 10885965
[(1R)-1-benzyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]-[(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methanone (PubChem CID 10885965) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is [(1R)-1-benzyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]-[(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methanone.
| Compound Name | [(1R)-1-benzyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]-[(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methanone |
|---|---|
| PubChem CID | 10885965 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | [(1R)-1-benzyl-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-2-yl]-[(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]methanone |
| SMILES | Cn1c2c(c3ccccc31)CCN(C(=O)[C@@]13O[C@H]4COC(C)(C)O[C@H]4[C@@H]1OC(C)(C)O3)[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C31H36N2O6/c1-29(2)35-18-24-26(37-29)27-31(36-24,39-30(3,4)38-27)28(34)33-16-15-21-20-13-9-10-14-22(20)32(5)25(21)23(33)17-19-11-7-6-8-12-19/h6-14,23-24,26-27H,15-18H2,1-5H3/t23-,24+,26-,27+,31-/m1/s1 |
| InChIKey | KCLGSLDYCQXCSC-ZDRHCSRCSA-N |
| XLogP | 4.24 |
| TPSA | 71.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|