C22H32N2O6 — CID 10669811
(3S)-2-benzyl-3-methyl-6-[(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]-1,2,5-oxadiazinane (PubChem CID 10669811) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is (3S)-2-benzyl-3-methyl-6-[(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]-1,2,5-oxadiazinane.
| Compound Name | (3S)-2-benzyl-3-methyl-6-[(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]-1,2,5-oxadiazinane |
|---|---|
| PubChem CID | 10669811 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (3S)-2-benzyl-3-methyl-6-[(1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-6-yl]-1,2,5-oxadiazinane |
| SMILES | C[C@H]1CNC([C@@]23O[C@H]4COC(C)(C)O[C@H]4[C@@H]2OC(C)(C)O3)ON1Cc1ccccc1 |
| InChI | InChI=1S/C22H32N2O6/c1-14-11-23-19(29-24(14)12-15-9-7-6-8-10-15)22-18(28-21(4,5)30-22)17-16(26-22)13-25-20(2,3)27-17/h6-10,14,16-19,23H,11-13H2,1-5H3/t14-,16-,17+,18-,19?,22+/m0/s1 |
| InChIKey | RATPGZVHKSPEGO-AYUZNKRLSA-N |
| XLogP | 2.14 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |