C35H37NO10 — CID 162405218
[4-[1-(benzhydrylideneamino)-2-methoxycarbonyloxyethyl]phenyl] (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate (PubChem CID 162405218) has the molecular formula C35H37NO10 and a molecular weight of 631.68 g/mol. Its IUPAC name is [4-[1-(benzhydrylideneamino)-2-methoxycarbonyloxyethyl]phenyl] (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate.
| Compound Name | [4-[1-(benzhydrylideneamino)-2-methoxycarbonyloxyethyl]phenyl] (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate |
|---|---|
| PubChem CID | 162405218 |
| Molecular Formula | C35H37NO10 |
| Molecular Weight | 631.68 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | [4-[1-(benzhydrylideneamino)-2-methoxycarbonyloxyethyl]phenyl] (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate |
| SMILES | COC(=O)OCC(N=C(c1ccccc1)c1ccccc1)c1ccc(OC(=O)[C@@]23O[C@H]4COC(C)(C)O[C@H]4[C@@H]2OC(C)(C)O3)cc1 |
| InChI | InChI=1S/C35H37NO10/c1-33(2)41-21-27-29(44-33)30-35(43-27,46-34(3,4)45-30)31(37)42-25-18-16-22(17-19-25)26(20-40-32(38)39-5)36-28(23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-19,26-27,29-30H,20-21H2,1-5H3/t26?,27-,29+,30-,35+/m0/s1 |
| InChIKey | XLCVGXAFLUDCNJ-NSUSCGSASA-N |
| XLogP | 5.35 |
| TPSA | 120.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|