C19H18O4 — CID 140969500
(3-phenoxyphenyl)methyl 2-formyl-1-methylcyclopropane-1-carboxylate (PubChem CID 140969500) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 2-formyl-1-methylcyclopropane-1-carboxylate.
| Compound Name | (3-phenoxyphenyl)methyl 2-formyl-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 140969500 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (3-phenoxyphenyl)methyl 2-formyl-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCc2cccc(Oc3ccccc3)c2)CC1C=O |
| InChI | InChI=1S/C19H18O4/c1-19(11-15(19)12-20)18(21)22-13-14-6-5-9-17(10-14)23-16-7-3-2-4-8-16/h2-10,12,15H,11,13H2,1H3 |
| InChIKey | JQPXOAKBBTWCAD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|