C25H29NO4 — CID 57010630
(3-phenoxyphenyl)methyl (1S)-3-[(cyclopentyloxyamino)methylidene]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 57010630) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl (1S)-3-[(cyclopentyloxyamino)methylidene]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (3-phenoxyphenyl)methyl (1S)-3-[(cyclopentyloxyamino)methylidene]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57010630 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (3-phenoxyphenyl)methyl (1S)-3-[(cyclopentyloxyamino)methylidene]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(=CNOC2CCCC2)[C@H]1C(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C25H29NO4/c1-25(2)22(16-26-30-20-12-6-7-13-20)23(25)24(27)28-17-18-9-8-14-21(15-18)29-19-10-4-3-5-11-19/h3-5,8-11,14-16,20,23,26H,6-7,12-13,17H2,1-2H3/t23-/m0/s1 |
| InChIKey | MKPZPQHUCJZAAX-QHCPKHFHSA-N |
| XLogP | 5.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|