C22H24O4 — CID 70559134
(3-phenoxyphenyl)methyl 2-(2-methoxyprop-1-enyl)-3-methylcyclopropane-1-carboxylate (PubChem CID 70559134) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 2-(2-methoxyprop-1-enyl)-3-methylcyclopropane-1-carboxylate.
| Compound Name | (3-phenoxyphenyl)methyl 2-(2-methoxyprop-1-enyl)-3-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 70559134 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (3-phenoxyphenyl)methyl 2-(2-methoxyprop-1-enyl)-3-methylcyclopropane-1-carboxylate |
| SMILES | COC(C)=CC1C(C)C1C(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H24O4/c1-15(24-3)12-20-16(2)21(20)22(23)25-14-17-8-7-11-19(13-17)26-18-9-5-4-6-10-18/h4-13,16,20-21H,14H2,1-3H3 |
| InChIKey | MVPQIAQRQQGUED-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|