C28H25NO3 — CID 54012056
(3-phenoxyphenyl)methyl 3-(1-cyano-2-phenylethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54012056) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 3-(1-cyano-2-phenylethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (3-phenoxyphenyl)methyl 3-(1-cyano-2-phenylethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54012056 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (3-phenoxyphenyl)methyl 3-(1-cyano-2-phenylethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C(=O)OCc2cccc(Oc3ccccc3)c2)C1C(C#N)=Cc1ccccc1 |
| InChI | InChI=1S/C28H25NO3/c1-28(2)25(22(18-29)16-20-10-5-3-6-11-20)26(28)27(30)31-19-21-12-9-15-24(17-21)32-23-13-7-4-8-14-23/h3-17,25-26H,19H2,1-2H3 |
| InChIKey | KTAUGTVQBFJTLL-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|