C26H28N2O4 — CID 57141917
[cyano-(3-phenoxyphenyl)methyl] (1S)-3-[(cyclopentyloxyamino)methylidene]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 57141917) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is [cyano-(3-phenoxyphenyl)methyl] (1S)-3-[(cyclopentyloxyamino)methylidene]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | [cyano-(3-phenoxyphenyl)methyl] (1S)-3-[(cyclopentyloxyamino)methylidene]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57141917 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [cyano-(3-phenoxyphenyl)methyl] (1S)-3-[(cyclopentyloxyamino)methylidene]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(=CNOC2CCCC2)[C@H]1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2O4/c1-26(2)22(17-28-32-20-12-6-7-13-20)24(26)25(29)31-23(16-27)18-9-8-14-21(15-18)30-19-10-4-3-5-11-19/h3-5,8-11,14-15,17,20,23-24,28H,6-7,12-13H2,1-2H3/t23?,24-/m0/s1 |
| InChIKey | QWOURCZJULAAPW-CGAIIQECSA-N |
| XLogP | 5.59 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|