C24H23NO3 — CID 57055249
[(S)-cyano-(3-phenoxyphenyl)methyl] (1R)-3-cyclobutylidene-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 57055249) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is [(S)-cyano-(3-phenoxyphenyl)methyl] (1R)-3-cyclobutylidene-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | [(S)-cyano-(3-phenoxyphenyl)methyl] (1R)-3-cyclobutylidene-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57055249 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [(S)-cyano-(3-phenoxyphenyl)methyl] (1R)-3-cyclobutylidene-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(=C2CCC2)[C@@H]1C(=O)O[C@H](C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H23NO3/c1-24(2)21(16-8-6-9-16)22(24)23(26)28-20(15-25)17-10-7-13-19(14-17)27-18-11-4-3-5-12-18/h3-5,7,10-14,20,22H,6,8-9H2,1-2H3/t20-,22-/m1/s1 |
| InChIKey | PSJCCVDXCILQLP-IFMALSPDSA-N |
| XLogP | 5.72 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|