C23H17Cl2NO5 — CID 86278697
(3-phenoxyphenyl)methyl 2,2-dichloro-1-(4-nitrophenyl)cyclopropane-1-carboxylate (PubChem CID 86278697) has the molecular formula C23H17Cl2NO5 and a molecular weight of 458.30 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 2,2-dichloro-1-(4-nitrophenyl)cyclopropane-1-carboxylate.
| Compound Name | (3-phenoxyphenyl)methyl 2,2-dichloro-1-(4-nitrophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 86278697 |
| Molecular Formula | C23H17Cl2NO5 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | (3-phenoxyphenyl)methyl 2,2-dichloro-1-(4-nitrophenyl)cyclopropane-1-carboxylate |
| SMILES | O=C(OCc1cccc(Oc2ccccc2)c1)C1(c2ccc([N+](=O)[O-])cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C23H17Cl2NO5/c24-23(25)15-22(23,17-9-11-18(12-10-17)26(28)29)21(27)30-14-16-5-4-8-20(13-16)31-19-6-2-1-3-7-19/h1-13H,14-15H2 |
| InChIKey | SDAXXLMFXQLDJE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|