C25H21Cl2NO6 — CID 139602111
[3-(4-nitrophenoxy)phenyl]methyl 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate (PubChem CID 139602111) has the molecular formula C25H21Cl2NO6 and a molecular weight of 502.35 g/mol. Its IUPAC name is [3-(4-nitrophenoxy)phenyl]methyl 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate.
| Compound Name | [3-(4-nitrophenoxy)phenyl]methyl 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139602111 |
| Molecular Formula | C25H21Cl2NO6 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | [3-(4-nitrophenoxy)phenyl]methyl 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylate |
| SMILES | CCOc1ccc(C2(C(=O)OCc3cccc(Oc4ccc([N+](=O)[O-])cc4)c3)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C25H21Cl2NO6/c1-2-32-20-10-6-18(7-11-20)24(16-25(24,26)27)23(29)33-15-17-4-3-5-22(14-17)34-21-12-8-19(9-13-21)28(30)31/h3-14H,2,15-16H2,1H3 |
| InChIKey | KTWBUSSQPUISOY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|