C13H22O3 — CID 89313667
tert-butyl (3R)-4-ethenyl-2,2-dimethyloxolane-3-carboxylate (PubChem CID 89313667) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is tert-butyl (3R)-4-ethenyl-2,2-dimethyloxolane-3-carboxylate.
| Compound Name | tert-butyl (3R)-4-ethenyl-2,2-dimethyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 89313667 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | tert-butyl (3R)-4-ethenyl-2,2-dimethyloxolane-3-carboxylate |
| SMILES | C=CC1COC(C)(C)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22O3/c1-7-9-8-15-13(5,6)10(9)11(14)16-12(2,3)4/h7,9-10H,1,8H2,2-6H3/t9?,10-/m0/s1 |
| InChIKey | ZPWZTWJOGPPICQ-AXDSSHIGSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|