About tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate
tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate (PubChem CID 121000177) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate.
Analyze tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate?
The IUPAC name of tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate (CID 121000177) is tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate.
What is the SMILES notation for tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate?
The canonical SMILES for tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate is C=CN1COC(C)(C)C1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate?
The InChIKey is WHEMZRDZRAAVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-7-13-8-15-12(5,6)9(13)10(14)16-11(2,3)4/h7,9H,1,8H2,2-6H3.
What are the key properties of tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate?
tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate has a molecular weight of 227.30 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-ethenyl-5,5-dimethyl-1,3-oxazolidine-4-carboxylate is sourced from PubChem (CID 121000177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).