C13H21NO3 — CID 57059917
tert-butyl (4S,5R)-4-ethenyl-5-(oxiran-2-yl)pyrrolidine-2-carboxylate (PubChem CID 57059917) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-ethenyl-5-(oxiran-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-ethenyl-5-(oxiran-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57059917 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl (4S,5R)-4-ethenyl-5-(oxiran-2-yl)pyrrolidine-2-carboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC(C)(C)C)N[C@H]1C1CO1 |
| InChI | InChI=1S/C13H21NO3/c1-5-8-6-9(12(15)17-13(2,3)4)14-11(8)10-7-16-10/h5,8-11,14H,1,6-7H2,2-4H3/t8-,9?,10?,11-/m1/s1 |
| InChIKey | RABJZJNWNKRXIB-AGVGLQIMSA-N |
| XLogP | 1.26 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|