C12H21NO4 — CID 178195379
tert-butyl (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]oxazine-2-carboxylate (PubChem CID 178195379) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is tert-butyl (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]oxazine-2-carboxylate.
| Compound Name | tert-butyl (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]oxazine-2-carboxylate |
|---|---|
| PubChem CID | 178195379 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | tert-butyl (4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]oxazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CO[C@H]2COCC[C@H]2N1 |
| InChI | InChI=1S/C12H21NO4/c1-12(2,3)17-11(14)9-6-16-10-7-15-5-4-8(10)13-9/h8-10,13H,4-7H2,1-3H3/t8-,9?,10+/m1/s1 |
| InChIKey | IRDFDLLKCTXSQL-FIBVVXLUSA-N |
| XLogP | 0.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |