About tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate
tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate (PubChem CID 171795451) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate |
| PubChem CID | 171795451 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate |
| SMILES | CC1CC(C(=O)OC(C)(C)C)N[C@@H]1C |
| InChI | InChI=1S/C11H21NO2/c1-7-6-9(12-8(7)2)10(13)14-11(3,4)5/h7-9,12H,6H2,1-5H3/t7?,8-,9?/m1/s1 |
| InChIKey | KADQVGOEDATENM-QJAFJHJLSA-N |
| XLogP | 1.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate?
The IUPAC name of tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate (CID 171795451) is tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate.
What is the SMILES notation for tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate?
The canonical SMILES for tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate is CC1CC(C(=O)OC(C)(C)C)N[C@@H]1C.
What is the InChIKey of tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate?
The InChIKey is KADQVGOEDATENM-QJAFJHJLSA-N. The full InChI is InChI=1S/C11H21NO2/c1-7-6-9(12-8(7)2)10(13)14-11(3,4)5/h7-9,12H,6H2,1-5H3/t7?,8-,9?/m1/s1.
What are the key properties of tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate?
tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate has a molecular weight of 199.29 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (5R)-4,5-dimethylpyrrolidine-2-carboxylate is sourced from PubChem (CID 171795451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).