C22H34N4O5 — CID 101407699
tert-butyl N-[(1R,2S)-5-azido-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypentan-2-yl]carbamate (PubChem CID 101407699) has the molecular formula C22H34N4O5 and a molecular weight of 434.54 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-5-azido-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-5-azido-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 101407699 |
| Molecular Formula | C22H34N4O5 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | tert-butyl N-[(1R,2S)-5-azido-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN=[N+]=[N-])[C@@H](OCc1ccccc1)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H34N4O5/c1-21(2,3)31-20(27)25-17(12-9-13-24-26-23)19(18-15-29-22(4,5)30-18)28-14-16-10-7-6-8-11-16/h6-8,10-11,17-19H,9,12-15H2,1-5H3,(H,25,27)/t17-,18-,19+/m0/s1 |
| InChIKey | ZTOKHPZKKPCDOV-GBESFXJTSA-N |
| XLogP | 4.71 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|