C28H34N2O3 — CID 22032681
tert-butyl 4-[(4-tert-butylphenyl)methylamino]-3-isoquinolin-5-yl-4-oxobutanoate (PubChem CID 22032681) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is tert-butyl 4-[(4-tert-butylphenyl)methylamino]-3-isoquinolin-5-yl-4-oxobutanoate.
| Compound Name | tert-butyl 4-[(4-tert-butylphenyl)methylamino]-3-isoquinolin-5-yl-4-oxobutanoate |
|---|---|
| PubChem CID | 22032681 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | tert-butyl 4-[(4-tert-butylphenyl)methylamino]-3-isoquinolin-5-yl-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)CC(C(=O)NCc1ccc(C(C)(C)C)cc1)c1cccc2cnccc12 |
| InChI | InChI=1S/C28H34N2O3/c1-27(2,3)21-12-10-19(11-13-21)17-30-26(32)24(16-25(31)33-28(4,5)6)23-9-7-8-20-18-29-15-14-22(20)23/h7-15,18,24H,16-17H2,1-6H3,(H,30,32) |
| InChIKey | SLGSIBQWHCARCJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |