C18H24N3O2- — CID 58824148
2-[isoquinolin-5-yl-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]ethylazanide (PubChem CID 58824148) has the molecular formula C18H24N3O2- and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-[isoquinolin-5-yl-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]ethylazanide.
| Compound Name | 2-[isoquinolin-5-yl-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]ethylazanide |
|---|---|
| PubChem CID | 58824148 |
| Molecular Formula | C18H24N3O2- |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 2-[isoquinolin-5-yl-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]ethylazanide |
| SMILES | CC(C)(C)OC(=O)CCN(CC[NH-])c1cccc2cnccc12 |
| InChI | InChI=1S/C18H24N3O2/c1-18(2,3)23-17(22)8-11-21(12-9-19)16-6-4-5-14-13-20-10-7-15(14)16/h4-7,10,13,19H,8-9,11-12H2,1-3H3/q-1 |
| InChIKey | LOSWSQLYVWPVNK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |