C19H16Cl2N2O — CID 22032667
N-[(3,5-dichlorophenyl)methyl]-2-isoquinolin-5-ylpropanamide (PubChem CID 22032667) has the molecular formula C19H16Cl2N2O and a molecular weight of 359.26 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-2-isoquinolin-5-ylpropanamide.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-2-isoquinolin-5-ylpropanamide |
|---|---|
| PubChem CID | 22032667 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-2-isoquinolin-5-ylpropanamide |
| SMILES | CC(C(=O)NCc1cc(Cl)cc(Cl)c1)c1cccc2cnccc12 |
| InChI | InChI=1S/C19H16Cl2N2O/c1-12(17-4-2-3-14-11-22-6-5-18(14)17)19(24)23-10-13-7-15(20)9-16(21)8-13/h2-9,11-12H,10H2,1H3,(H,23,24) |
| InChIKey | VKOBNWORTNFWHX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |