About 8-ethylisoquinoline;5-propan-2-ylisoquinoline
8-ethylisoquinoline;5-propan-2-ylisoquinoline (PubChem CID 169235936) has the molecular formula C23H24N2
and a molecular weight of 328.46 g/mol. Its IUPAC name is 8-ethylisoquinoline;5-propan-2-ylisoquinoline.
Molecular Properties
| Compound Name | 8-ethylisoquinoline;5-propan-2-ylisoquinoline |
| PubChem CID | 169235936 |
| Molecular Formula | C23H24N2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 8-ethylisoquinoline;5-propan-2-ylisoquinoline |
| SMILES | CC(C)c1cccc2cnccc12.CCc1cccc2ccncc12 |
| InChI | InChI=1S/C12H13N.C11H11N/c1-9(2)11-5-3-4-10-8-13-7-6-12(10)11;1-2-9-4-3-5-10-6-7-12-8-11(9)10/h3-9H,1-2H3;3-8H,2H2,1H3 |
| InChIKey | ZSOHWOGFCJTVLD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethylisoquinoline;5-propan-2-ylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethylisoquinoline;5-propan-2-ylisoquinoline?
The IUPAC name of 8-ethylisoquinoline;5-propan-2-ylisoquinoline (CID 169235936) is 8-ethylisoquinoline;5-propan-2-ylisoquinoline.
What is the SMILES notation for 8-ethylisoquinoline;5-propan-2-ylisoquinoline?
The canonical SMILES for 8-ethylisoquinoline;5-propan-2-ylisoquinoline is CC(C)c1cccc2cnccc12.CCc1cccc2ccncc12.
What is the InChIKey of 8-ethylisoquinoline;5-propan-2-ylisoquinoline?
The InChIKey is ZSOHWOGFCJTVLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N.C11H11N/c1-9(2)11-5-3-4-10-8-13-7-6-12(10)11;1-2-9-4-3-5-10-6-7-12-8-11(9)10/h3-9H,1-2H3;3-8H,2H2,1H3.
What are the key properties of 8-ethylisoquinoline;5-propan-2-ylisoquinoline?
8-ethylisoquinoline;5-propan-2-ylisoquinoline has a molecular weight of 328.46 g/mol, XLogP of 6.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethylisoquinoline;5-propan-2-ylisoquinoline is sourced from PubChem (CID 169235936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).