C27H22ClFN2O2 — CID 141063781
3-chloro-4-fluoro-N-[[3-(2-naphthalen-1-ylpropanoylamino)phenyl]methyl]benzamide (PubChem CID 141063781) has the molecular formula C27H22ClFN2O2 and a molecular weight of 460.94 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[[3-(2-naphthalen-1-ylpropanoylamino)phenyl]methyl]benzamide.
| Compound Name | 3-chloro-4-fluoro-N-[[3-(2-naphthalen-1-ylpropanoylamino)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 141063781 |
| Molecular Formula | C27H22ClFN2O2 |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3-chloro-4-fluoro-N-[[3-(2-naphthalen-1-ylpropanoylamino)phenyl]methyl]benzamide |
| SMILES | CC(C(=O)Nc1cccc(CNC(=O)c2ccc(F)c(Cl)c2)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H22ClFN2O2/c1-17(22-11-5-8-19-7-2-3-10-23(19)22)26(32)31-21-9-4-6-18(14-21)16-30-27(33)20-12-13-25(29)24(28)15-20/h2-15,17H,16H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | XAXSCUZPQSXDMR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |