C32H37N3O6S — CID 90803836
tert-butyl N-[2-[(6-methoxy-3-pyridinyl)-naphthalen-1-ylsulfonylamino]ethyl]-N-(2-phenylmethoxyethyl)carbamate (PubChem CID 90803836) has the molecular formula C32H37N3O6S and a molecular weight of 591.73 g/mol. Its IUPAC name is tert-butyl N-[2-[(6-methoxy-3-pyridinyl)-naphthalen-1-ylsulfonylamino]ethyl]-N-(2-phenylmethoxyethyl)carbamate.
| Compound Name | tert-butyl N-[2-[(6-methoxy-3-pyridinyl)-naphthalen-1-ylsulfonylamino]ethyl]-N-(2-phenylmethoxyethyl)carbamate |
|---|---|
| PubChem CID | 90803836 |
| Molecular Formula | C32H37N3O6S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | tert-butyl N-[2-[(6-methoxy-3-pyridinyl)-naphthalen-1-ylsulfonylamino]ethyl]-N-(2-phenylmethoxyethyl)carbamate |
| SMILES | COc1ccc(N(CCN(CCOCc2ccccc2)C(=O)OC(C)(C)C)S(=O)(=O)c2cccc3ccccc23)cn1 |
| InChI | InChI=1S/C32H37N3O6S/c1-32(2,3)41-31(36)34(21-22-40-24-25-11-6-5-7-12-25)19-20-35(27-17-18-30(39-4)33-23-27)42(37,38)29-16-10-14-26-13-8-9-15-28(26)29/h5-18,23H,19-22,24H2,1-4H3 |
| InChIKey | ANVXAWHDNWHHPH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|